![]() |
![]() |
![]() |
Cultural Aspects Product Development Recipes Sensory Safety References
|
Dedicated to improving the lives, health, and environment of individuals, families and communities.
What is the relationship of the iodine value and solidity of fat? of melting point? Explain. Fat deterioration may occur due to a number of reasons. list and define the three types of rancidity.
Define and briefly indication the implications in food of the following:
What are some of the special treatments given to rendered animal fats or crude vegertable oils to make them more desirable products for certain purposes? Why refine products? Discuss the process of hydrogenation and its' effect in fats and oils. Why is it used? Hillary was interested in making a whitesauce for a cheese souffle. She had two fat mixtures to use and was not concerned about flavor or color in making her choice. Fat A was clarified purified butter which had not undergone any hydrolytic rancidity. Fat B was clarified butter which had undergone a 5% hydrolysis of the triglycerides due to hydrolytic rancidity. What would you expect to be the influence upon the viscosity of the gelatinized starch paste? Explain your answer. What causes mayonnaise to thicken as it is prepared? List changes in specific foods and their qualities of oil (or fat) was soluble in water. Be specific. What is the role(s) of lipids in: fruit, starch gelatinization, frozen dessert crystallization, meat production/quality? Mastery of the following reaction is not in itself of critical importance; however, an understanding of it does serve to explain certain phenomena which affect food quality. Show the synthesis and hydrolysis of a triglyceride. Show the synthesis and hydrolysis of a triglyceride relates related to hydrolytic rancidity. If one wishes to prepare a fat spread (spread for bread) to be used in a desert survival program in California, which one of the triglycerides would predominant? Which of the fats would be most susceptible to rancidity as evidenced by free radicals, hydroperoxides, aldehydes, and ketones? Which of the lipids is likely the least "sensitive" (or prone) to oxidative rancidity? Which triglyceride would likely be incorporated in shortening to be used as an emulsifier for a shortened cake? Coconut oil is inexpensive and often used in commercial food products. Coconut oil is a saturated fat. How can this be an oil and yet be saturated? What determines the melting point of a fat? Of what importance is the melting point of a fat in food preparation? If there were two isomers of triglycerides B, one having "hydrogen" in CIS form and the other in the TRANS form, which would likely have the higher melting point? Why? What would be the most desirable characteristic to consider if you were choosing a fat to make French salad dressing? Hillary measured the iodine number of 2 fats which appeared to be equally solid ?! One had a "high" number and the second had a "low" number. Explain the probably reason(s) for the similarities and differences. What are some of the special treatments given to rendered animal fats or crude vegetable oils to make them more desirable products for certain purposes? Discuss the process of hydrogenation and its' effect in fats and oils. Why is it used? Briefly discuss the process of interesterification and rearrangementand it's effect in fats and oils. Why is it used? Hillary got ready to use a special fat she had ordered. It was 100% triglyceride and so she began to make a cake; but, it was hard to aerate: first it was a solid, then a liquid, then it turned a solid again. What would be the most appropriate explanation? Hillary, from Northern California, went to the American Dietetic Association meeting in California last October and met her friends from Bangor, Maine and Houston, Texas. The discussion came up about a new sweet chocolate product they all were using in their food service as a snack. Hillary was really enthusiastic about the fantastic product. Both her Maine friend and Texas friend said they were surprised as they thought it was a lousy product. The Maine friend said the crystals were so fine and small the texture was too hard; yet, the Texas friend indicated that the same chocolate just had the opposite problem. The texture was just like syrup due to the very large crystal size. Explain the probably reason for this difference. Also, indicate why these three food service managers got such a different product when it left the factory as one identical product. Discuss polymorphism of fats: occurrence, impact on fat characteristics, impact on food quality, Hillary measured the iodine number of two fats which appeared to be equally solid. One had a "high" number and the second had a "low" number. Explain the probably reason(s) for the similarities and differences. Hillary wanted to develop a "house dressing". She had a choice of several oils and several thickening agents. Using data furnished in Table 1 for melting point and iodine value, which fat would most likely permit Hillary to make a "French-style house dressing. Characteristics of fats and thickening agents. FAT MELTING SMOKE IODINE THICKENING EMULSION POINT. C POINT. C VALUE AGENT* STABILITY** A 16 160 106 A 8.0 B 43 160 106 B 2.5 C 23 40 37 C 8.0 D -10 180 136 D 12.5 E 5 130 67 E 6.0 *Used in conjunction with Fat A only to form emulsions. **Milliliters separation after shaking. Hillary heard about fats which were polymorphic. A salesman told her Fat A or B were the same lipid composition, just different polymorphic forms of lipids. Which fat likely has the most fatty acids with trans form of double bonds? Explain. Discuss why bubbling hydrogen through a soybean oil will not serve as an antioxidant acting agent for oxidative rancidity. The four types of rancidity in fats are: absorption of odors, action of microorganisms, action of enzymes (lipases), atmospheric oxidation. Briefly define and show the reaction indicative of action of enzymes (lipases). What are the factors promoting rancidity and the products resulting? What is oxidative rancidity? Diagram the free-radical chain mechanism which has been proposed in oxidative rancidity. Compare types of rancidity by completing the attached chart Comparison Hydrolytic Oxidase type of foods for which it is the greatest problem portion of fat molecules reacting most sensitive way to detect end products of reaction methods to inhibit the reaction What tests might you use to differentiate between the reactions in oxidative and hydrolytic rancidity? Briefly define and show the reaction(s) of oxidative rancidity (nonenzyme). INITIATION PROPOGATION TERMINATION List factors affecting autoxidation. What is an emulsion? Discuss factors giving stability. List factors used to increase emulsifications and/or emulsion stability. How can a "broken" emulsion be reformed? What are emulsifying agents? What "qualities" should they have? How do they function? What is the mechanism? List examples. What is the influence of the interfacial tensions in an emulsion? How do emulsifiers influence the type of emulsion (O/W, W/O)? Why? Describe and discuss (diagram and words) the process of oxidative rancidity Describe how emulsions are formed and stabilized. If there were two isomers of a triglyceride, one having the "hydrogen" in CIS form and the other in the TRANS form, which would likely have the higher melting point? CIS or TRA Explain your answer What is a lipid? a fat? an oil? What are the types of fat rancidity? For each: what are the factors promoting this type of rancidity and the products resulting? What are some of the special treatments given to rendered animal fats or crude vegetable oils to make them more desirable products for certain purposes? What is an emulsion? Discuss factors giving stability. With popular emphasis on the use of salad oils, what modifications of conventional recipes are necessary to substitute these for plastic fats? DEFINE THE FOLLOWING winterization or rearrangement degumming or bleaching hydrogenation emulsions What is the difference between a fat, a oil, a lipid? What contributions do fats make in foods? Where do we use fat in foods? With popular emphasis on the use of salad oils, what modifications of conventional recipes are necessary to substitute these for plastic fats? Complete the diagram below to show the synthesis and hydrolysis of a triglyceride. H O H O | | H-C-OH OH-C-(CH2)7CH=CH(CH2)7CH3 H-C- -C- (CH2)7CH=CH(CH2)7CH3 | | | O | O | | H-C-OH OH-C-(CH2)16CH3 ------->H-C- -C-(CH2)16CH3 | <------- | | O | O | | H-C-OH OH-C-(CH2)7CH=CH(CH2)7CH3 H-C- -C- (CH2)7CH=CH(CH2)7CH3 | | H H Mastery of the above reaction is not in itself of critical importance; however, an understanding of it does serve to explain certain phenomena which affect food quality. Discuss in what way the previous diagram on the synthesis and hydrolysis of a triglyceride relates to hydrolytic rancidity. What is oxidative rancidity? What portion of the previous diagram relates to oxidative rancidity? Coconut oil is inexpensive and often used in commercial food products. Coconut oil is a saturated fat. How can this be an oil and yet be saturated? What would be the most desirable characteristic to consider if you were choosing a fat to make French salad dressing? What is the major reason a salad dressing is called low calorie? In mayonnaise, where would the following be found in the emulsion? vinegar PHASE oil a. dispersed phase paprika b. continuous phase emulsifying agent c. interface mustard Diagrams of chemical formulas of four selected triglycerides. H O H O | | H-C-0-C-(CH2)16-CH3 H-C-0-C-(CH2)7CH=CH(CH2)7CH3 | O | O H-C-O-C-(CH2)14CH3 H-C-O-C-(CH2)7CH=CH-CH2CH=CH(CH2)4CH3 | O | O H-C-O-C-(CH2)7CH=CH(CH2)7CH3 H-C-O-C-(CH2)7CH=CHCH2CH=CH(CH2)4CH3 | | H H TRIGLYCERIDE A TRIGLYCERIDE B H O H O | | H-C-O-C-(CH2)14CH3 H-C-O-C-(CH2)14CH3 | O | O H-C-O-C-(CH2)10CH3 H-C-O-C-(CH2)14CH3 | O | O H-C-O-C-(CH2)7CH=CHCH2CH=CH H-C-O-C-(CH2)7CH=CH(CH2)7CH3 | (CH2)4CH3 TRIGLYCERIDE C TRIGLYCERIDE D Using the "Diagrams of Chemical Formulas of Selected Triglycerides" answer the following questions. AFter you select your answer, write a very brief justification of your choice. Which triglyceride likely has the lowest melting point? Which triglyceride likely has the widest plastic range? Which triglyceride likely has the narrowest plastic range? Which fat is likely the most susceptible to changes brought about by hydrogenation? Is one of the triglycerides more susceptible to hydrolytic rancidity than the others? Which, or why? Is one of the triglycerides more susceptible to oxidative rancidity than the others? Which or why? Which triglyceride likely has the highest smoke point? Which triglyceride most likely needs to be kept refrigerated? Which triglyceride is best to use in salad dressing/mayonnaise preparation? Which is best to use in deepfat frying? Which is best to use to make a meally pastry? Which triglyceride has the most pronounced odor? Which triglycerides is most likely an oil? Which triglyceride is the most effective emulsifying agent? Which triglyceride most easy to maintain a foam dispersion? Which triglyceride most flavor to a product? If one wished to prepare a fat spread (spread for bread) to be used in a desert survival program in California, which one of the triglycerides would predominant? What would be the influence of adding a monoglyceride to fat D on smoke point? Which triglyceride would likely be incorporated in shortening to be used as an emulsifier for a shortened cake? Which of the following triglycerides (fats) would be most firm at room temperature 27C, 70F)? a. tristearin (contains 18 carbon saturated fatty acids) b. triolein (contains 16 carbon saturated fatty acids) c. triliolein (contains 18 carbons and 2 double bonds in fatty acids) d. tributyrin (contains 4 carbon saturated fatty acids) One day some butter melted and Hillary decided to cool it slowly. Which of the following best describes this product? (Note: think of the results in comparison of contrast of the melted butter rapidly cooled). a. This butter would likely have better plascitiy. b. Cooling rate does not influence crystallinity in fats. c. The dispersion would likely look more solid as opposed to showing the crystals in oily oil dispersion. d. The cooled butter likely would have large crystals dispersed in an "oily" appearing medium. a type of lipid consisting chemically of one molecule of glycerol combined with three fatty acids a. fatty acid b. monoglyceride c. phospholipid d. sterol e. triglyceride deterioration of fats, usually by an oxidation process, resulting in objectionable flavors and odors. a. frying b. hydrogenation c. isomerization d. rancidity e. winterization term used to describe a broad group of substances with similar properties or characteristics of insolubility in water and a greasy feel. a. carbohydrate b. cellulose c. lipid d. protein a substance that stops unwanted oxidations a. antioxidant b. emulsifying agent c. oxidant d. rancidity e. Term to describe the ability of a fat to be molded or shaped. a. emulsification b. hydrogenation c. plasticity d. rancidity e. winterization Term for removal of triglycerides with high melting points from oil to be used as salad oil a. emulsification b. hydrogenation c. plasticity d. rancidity e. winterization Term for process to change liquid oils to solid or pliable shortenings. a. emulsification b. hydrogenation c. plasticity d. rancidity e. winterization Term for deterioration of fats resulting in objectionable odor or flavor. a. emulsification b. hydrogenation c. plasticity d. rancidity e. winterization A fatty acid with no double bonds between carbon atoms; it holds all of the hydrogen that can be attached to the carbon atoms a. linolenic acid b. linoleic acid c. saturated fatty acid d. oleic acid e. unsaturated fatty acid A type of lipid consisting chemically of one molecule of glycerol combined with three fatty acids a. fatty acid b. monoglyceride c. phospholipid d. sterol e. triglyceride Which of the following triglycerides (fats) would be most firm at room temperature 27C, 70F)? a. tristearin (contains 18 carbon saturated fatty acids) b. triolein (contains 16 carbon saturated fatty acids) c. triliolein (contains 18 carbons and 2 double bonds in fatty acids) d. tributyrin (contains 4 carbon saturated fatty acids) The characteristics of the fatty acid is very important as generally a triglyceride containing fatty acids of equal length but more of the fatty acids are saturated than unsaturated would be (as opposed to the reverse situation) a. more likely to be a liquid at room temperature and be more soluble and more polar in liquid (water) dispersions. b. more likely to be a solid at room temperature and be less polar and less soluble in liquid (water) dispersions. c. more likely to be a liquid at room temperature and be less soluble and less polar in liquid (water ) dispersions. d. more likely to be a solid at room temperature and be more polar and more soluble in liquid (water) dispersions. One day some butter melted and Hillary decided to cool it slowly. Which of the following best describes this product? (Note: think of the results in comparison of contrast of the melted butter rapidly cooled). a. This butter would likely have better plasticitiy. b. Cooling rate does not influence crystallinity in fats. c. The dispersion would likely look more solid as opposed to showing the crystals in oily oil dispersion. d. The cooled butter likely would have large crystals dispersed in an "oily" appearing medium. From the listing on the right hand column, indicate how these ingredients and procedures affect mayonnaise formation. EMULSION FORMATION Refrigerator temperature salad oil. a. Promote emulsion formation Egg yolk. b. Inhibit emulsion formation Wide, flat bottom bowl. c. No appreciable influence Stirring with a spoon rather than on emulsion formation beating with a beater. Lemon juice used rather than vinegar. Previously made mayonnaise is added to the egg yolk/vinegar mixture. In mayonnaise, where would the following be found in the emulsion? vinegar a. dispersed phase oil b. continuous phase paprika c. interface emulsifying agent Which is a fatty acid with no double bonds between carbon atoms; it holds all of the hydrogen that can be attached to the carbon atoms a. butyric acid b. caproic acid c. saturated fatty acid d. stearic acid e. unsaturated fatty acid Check each substance which may be used in food products to act as an emulsifier. a. dry mustard d. oil b. water e. paprika c. egg yolk f. lemon juice The process of adding hydrogen at the double bond of selected unsaturated fatty acids to make a more plastic fat is: a. rearrangement b. winterizing c. emulsification d. hydrogenation What are the differences in stability between saturated and unsaturated fats? A plastic fat with emulsifiers added is better than one without for use in which of the following products? What is the definition of hydrogenated fat? Differences in stability between saturated and unsaturated fats include what characteristics? Which of the following triglycerides (fats) would be most firm at room temperature 27À$ÀC, 70À$ÀF)? a. Tristearin (contains 18 carbon saturated fatty acids) b. Triolein (contains 16 carbon saturated fatty acids) c. Trilinolein (contains 18 carbons and 2 double bonds in fatty acids) d. Tributyrin (contains 4 carbon saturated fatty acids) Which of the following most accurately reflects triglycerides role in fats? a. Triglycerides make up fats and permits the accurate prediction of the characteristics of the fats. b. Triglycerides are organic compounds which are occasionally found in fats; but, fats are really only made up of lipids. c. Fats are complex ingredients made up of many component parts so there is just no way to find out the characteristics of the fats. What is a common fat, which in composition is only 80% fat? Processing the two terms at the left, indicate the correct type of rancidity that would occur for each situation. A. oxidative rancidity triglyceride is split to glycerol and B. hydrolytic rancidity free fatty acid presence of lipase an oxygen interceptor (antioxidant helps prevent this saturated fatty acids involved Define and indicate the three major catagories of lipids. Why are simple and mixed glycerides important? Which of the following most accurately reflects triglycerides role in fats? a. triglycerides make up fats and permits the accurate prediction of the characteristics of the fats. b. triglycerides are organic compounds which are occasionally found in fats; but, fats are really only made up of lipids. c. fats are complex ingredients made up of many component parts so there is just no way to find out the characteristics of the fats. Define the following: refined fats and oils used in food preparation, including edible oils, margarine, butter, lard, and shortenings a chemical molecule consisting of carbon and hydrogen atoms bonded in a chainlike structure; combined through its acid group (-COOH) with the alcohol glycerol to form triglycerides. temperature at which a solid fat becomes a liquid oil ability to be molded or shaped; in plastic fats, both solid crystals and liquid oil are present describing substances that cannot be mixed or blended an enzyme that activates hydrolytic rancidity in a triglyceride amount of oil required by USDA to label a permanent emulsion mayonnaise deterioration of fats, usually by an oxidation process, resulting in objectionable flavors and odors. The process of adding hydrogen at the double bond of selected unsaturated fatty acids to make a more plastic fat Indicate whether the following statements are true or false. saturated fats are not susceptible to any rancidity unsaturated fats are a liquid so rancidity is not a problem antioxidants must be added to any saturated fat to prevent rancidity unsaturated fats are more readily susceptible to a common type of oxidative rancidity Fats should be stored best stored in which of the following a. in a warm place b. no longer than one week c. in a dark air-tight container d. in the pan used for deep fat frying Check each substance which may be used in food products to act as an emulsifier. dry mustard oil water paprika egg yolk lemon juice What are characteristics of selected fatty acids?
URL Home: <http://food.oregonstate.edu/> Email maybe sent to food at oregonstate.edu Updated: Wednesday, April 21, 2010. | ||||||||||||||||||||||||
![]() OSU Disclaimer. |