Food Resource

Cultural Aspects
Product Development
Recipes
Sensory
Safety
References

FAQ

Contact Us

| Educ.& Training
Serv.
| Glossary | References | Image Pages | Faq
to Top

Site Sponsor to Top



Be descriptive for better search results.
What are common fatty acids?
What are the contributions of fats to foods?
Why is it of interest to know about fatty acids and how triglycerides are formed?
How important is the absorption value of icing shortening?
Is there a difference between margarines and hydrogenated fats?
What is fat crystallization?
If there were two isomers of triglycerides B, one having "hydrogen" in CIS form and the other in the TRANS form, which would likely have the higher melting point? Why?
Which of the following triglycerides (fats) would be most firm at room temperature 27C, 70F)?
Why are there off-odors and - flavors in oil and shortening?
I'm wondering whether you'd be willing to help me think through some food science. A woman's pie is not "setting up". The ingredients are margarine, sugar, melted chocolate, and whipped eggs. It's an uncooked recipe. When she made this in Portland, it worked. In Central Oregon, it doesn't firm. I can't figure out why it sets up at all. I wondered if gelatin was needed - or if the pie should be cooked to coagulate the eggs. I also am perplexed why a higher altitude might be affecting this.
What is an unsaturated fatty acid? What is a saturated fatty acid?
What contributions do fats make in foods? Where do we use fat in foods?

Which do you think is the major role of the fat or oil: a tenderizer, flavor contributor, leavener, structure - in the following products?

Why is it of interest to know about fatty acids and how triglycerides are formed? What are the differences in between saturated and unsaturated fats include what characteristics?

Mastery of the following reaction is not in itself of critical importance; however, an understanding of it does serve to explain certain phenomena which affect food quality.

Show the synthesis and hydrolysis of a triglyceride.
Show the synthesis and hydrolysis of a triglyceride relates related to hydrolytic rancidity.

What are the catagories of fats?? Why would it make a difference in the following fat if they are polymorphic?

Crystal Types

_____________Palmitic
|
|_____________Oleic
|
|_____________Palmitic

_____________Palmitic
|
|_____________Palmitic
|
|_____________Oleic

_____________oleic
|
|_____________Palmitic
|
|_____________Palmitic

In reviewing the three possible arrangements of the fatty acids on the glycerol backbone, it becomes apparent that conformational and structural stress will impact the ability to crystallize. Remember, crystallization is the alignment of like molecules.


What determines the melting point of a fat? Of what importance is the melting point of a fat in food preparation?

Indicate the relationship of polymorphism to crystallization and possible influences on functional properties related to foods.

Discuss how the structure of triglycerides influence the crystallization of a fat.


Which of the above hypothetical fatty acids would be most susceptible to oxidation rancidity?

Which of the above unsaturated fatty acids if on a triglyceride which have the lowest melting point?

Which of the above saturated fatty acids if on a triglyceride which have the lowest melting point?

What determines the melting point of a fat? Of what importance is the melting point of a fat in food preparation?

If there were two isomers of triglycerides B, one having "hydrogen" in CIS form and the other in the TRANS form, which would likely have the higher melting point? Why?

Which of the following triglycerides (fats) would be most firm at room temperature 27C, 70F)?

  • tristearin (contains 18 carbon saturated fatty acids)
  • triolein (contains 16 carbon saturated fatty acids)
  • triliolein (contains 18 carbons and 2 double bonds in fatty acids)
  • tributyrin (contains 4 carbon saturated fatty acids)
  • One day some butter melted and Hillary decided to cool it slowly. What would describe this product? (Note: think of the results in comparison of contrast of the melted butter rapidly cooled).

    a. CH3-CH2-CH2-COOH

    b. CH3-(CH2)7CH=CH(CH2)7COOH

    c. CH3-(CH2)16-COOH


    Choose the appropriate fatty acid for the following questions.
    Which of the above fatty acids is most likely a solid?
    Which of the above fatty acids likely has the most odor?
    Which of the above fatty acid likely is liquid at room temperature?
    Which of the above fatty acid is susceptible to oxidative rancidity?
    Which of the above keep refrigerated best in salad dressings?
    If a triglyceride consisted of all of one fatty acid (unusual), which would most likely be used in salad dressing?

    Hillary, from Northern California, went to the American Dietetic Association meeting in California last October and met her friends from Bangor, Maine and Houston, Texas. The discussion came up about a new sweet chocolate product they all were using in their food service as a snack. Hillary was really enthusiastic about the fantastic product. Both her Maine friend and Texas friend said they were surprised as they thought it was a lousy product. The Maine friend said the crystals were so fine and small the texture was too hard; yet, the Texas friend indicated that the same chocolate just had the opposite problem. The texture was just like syrup due to the very large crystal size. Explain the probably reason for this difference. Also, indicate why these three food service managers got such a different product when it left the factory as one identical product.

    What is a common fat, which in composition is only 80% fat?

    What are some of the special treatments given to rendered animal fats or crude vegetable oils to make them more desirable products for certain purposes?

    Why does margarine look darker yellow than butter?

    What is the process of changing an oil to a solid?

    How should one store fats and oils?

    What are four types of rancidity?

    What are the roles and functions of fat and lipids?

    Briefly define and show the reaction indicative of action of enzymes (lipases).

    What are t he factors promoting rancidity and the products resulting?

    What are the types of fat rancidity? For each: what are the factors promoting this type of rancidity and the products resulting?

    to Top

    What is the relationship of the iodine value and solidity of fat? of melting point? Explain.

    Fat deterioration may occur due to a number of reasons. list and define the three types of rancidity.

    Define and briefly indication the implications in food of the following:
    lipid
    fat
    oil
    ampilic fats
    Processing of vegetable oils
    degumming
    alkali refining
    bleaching
    deodorization
    winterization

    cis version trans fatty acid
    emulsion
    flavor reversion
    rancidity
    linolenic acid
    HLB of 13
    diglyceride
    polymorphism
    interfacial tension
    surfactants
    HLB number
    antioxidant
    Hydrogenation
    B' crystal

    What are some of the special treatments given to rendered animal fats or crude vegertable oils to make them more desirable products for certain purposes?

    Why refine products? Discuss the process of hydrogenation and its' effect in fats and oils. Why is it used?

    Hillary was interested in making a whitesauce for a cheese souffle.

    She had two fat mixtures to use and was not concerned about flavor

    or

    color in making her choice. Fat A was clarified purified butter

    which

    had not undergone any hydrolytic rancidity. Fat B was clarified

    butter which had undergone a 5% hydrolysis of the triglycerides due

    to

    hydrolytic rancidity. What would you expect to be the influence

    upon

    the viscosity of the gelatinized starch paste? Explain your

    answer.

    What causes mayonnaise to thicken as it is prepared?

    List changes in specific foods and their qualities of oil (or fat) was

    soluble in water. Be specific.

    What is the role(s) of lipids in: fruit, starch gelatinization,

    frozen dessert crystallization, meat production/quality?

    Mastery of the following reaction is not in itself of critical

    importance; however, an understanding of it does serve to explain

    certain phenomena which affect food quality.

    Show the synthesis and hydrolysis of a triglyceride.

    Show the synthesis and hydrolysis of a triglyceride relates

    related to hydrolytic rancidity.

    If one wishes to prepare a fat spread (spread for bread) to be used in

    a desert survival program in California, which one of the

    triglycerides would predominant?

    Which of the fats would be most susceptible to rancidity as evidenced

    by free radicals, hydroperoxides, aldehydes, and ketones?

    Which of the lipids is likely the least "sensitive" (or prone) to

    oxidative rancidity?

    Which triglyceride would likely be incorporated in shortening to be

    used as an emulsifier for a shortened cake?

    Coconut oil is inexpensive and often used in commercial food products.

    Coconut oil is a saturated fat. How can this be an oil and yet be

    saturated?

    What determines the melting point of a fat? Of what importance

    is the melting point of a fat in food preparation?

    If there were two isomers of triglycerides B, one having "hydrogen" in

    CIS form and the other in the TRANS form, which would likely have the

    higher melting point? Why?

    What would be the most desirable characteristic to consider if you

    were choosing a fat to make French salad dressing?

    Hillary measured the iodine number of 2 fats which appeared to be

    equally solid ?! One had a "high" number and the second had a "low"

    number. Explain the probably reason(s) for the similarities and

    differences.

    What are some of the special treatments given to rendered animal fats

    or crude vegetable oils to make them more desirable products for

    certain purposes?

    Discuss the process of hydrogenation and its' effect in fats and oils.

    Why is it used?

    Briefly discuss the process of interesterification and rearrangementand it's effect in

    fats and oils. Why is it used?

    Hillary got ready to use a special fat she had ordered. It was 100%

    triglyceride and so she began to make a cake; but, it was hard to

    aerate: first it was a solid, then a liquid, then it turned a solid

    again. What would be the most appropriate explanation?

    Hillary, from Northern California, went to the American Dietetic

    Association meeting in California last October and met her friends

    from Bangor, Maine and Houston, Texas. The discussion came up about a

    new sweet chocolate product they all were using in their food service

    as a snack. Hillary was really enthusiastic about the fantastic

    product. Both her Maine friend and Texas friend said they were

    surprised as they thought it was a lousy product. The Maine friend

    said the crystals were so fine and small the texture was too hard;

    yet, the Texas friend indicated that the same chocolate just had the

    opposite problem. The texture was just like syrup due to the very

    large crystal size. Explain the probably reason for this difference.

    Also, indicate why these three food service managers got such a

    different product when it left the factory as one identical product.

    Discuss polymorphism of fats: occurrence, impact on fat

    characteristics, impact on food quality,

    Hillary measured the iodine number of two fats which appeared to be

    equally solid. One had a "high" number and the second had a "low"

    number. Explain the probably reason(s) for the similarities and

    differences.

    Hillary wanted to develop a "house dressing". She had a choice of

    several oils and several thickening agents. Using data furnished in

    Table 1 for melting point and iodine value, which fat would most

    likely permit Hillary to make a "French-style house dressing.

    Characteristics of fats and thickening agents.

    FAT MELTING SMOKE IODINE THICKENING EMULSION

    POINT. C POINT. C VALUE AGENT* STABILITY**

    A 16 160 106 A 8.0

    B 43 160 106 B 2.5

    C 23 40 37 C 8.0

    D -10 180 136 D 12.5

    E 5 130 67 E 6.0

    *Used in conjunction with Fat A only to form emulsions.

    **Milliliters separation after shaking.

    Hillary heard about fats which were polymorphic. A salesman told her

    Fat A or B were the same lipid composition, just different polymorphic

    forms of lipids. Which fat likely has the most fatty acids with trans

    form of double bonds? Explain.

    Discuss why bubbling hydrogen through a soybean oil will not serve as

    an antioxidant acting agent for oxidative rancidity.

    The four types of rancidity in fats are: absorption of odors, action

    of microorganisms, action of enzymes (lipases), atmospheric oxidation.

    Briefly define and show the reaction indicative of action of enzymes

    (lipases).

    What are the factors promoting rancidity and the products resulting?

    What is oxidative rancidity? Diagram the free-radical chain mechanism

    which has been proposed in oxidative rancidity.

    Compare types of rancidity by completing the attached chart

    Comparison

    Hydrolytic

    Oxidase

    type of foods for which it is

    the greatest problem

    portion of fat molecules

    reacting

    most sensitive way to detect

    end products of reaction

    methods to inhibit the reaction

    What tests might you use to differentiate between the reactions in

    oxidative and hydrolytic rancidity?

    Briefly define and show the reaction(s) of oxidative rancidity

    (nonenzyme).

    INITIATION

    PROPOGATION

    TERMINATION

    List factors affecting autoxidation.

    What is an emulsion? Discuss factors giving stability.

    List factors used to increase emulsifications and/or emulsion

    stability.

    How can a "broken" emulsion be reformed?

    What are emulsifying agents? What "qualities" should they have? How

    do they function? What is the mechanism? List examples.

    What is the influence of the interfacial tensions in an emulsion?

    How do emulsifiers influence the type of emulsion (O/W, W/O)? Why?

    Describe and discuss (diagram and words) the process of

    oxidative rancidity

    Describe how emulsions are formed and stabilized.

    If there were two isomers of a triglyceride, one having the

    "hydrogen" in CIS form and the other in the TRANS form, which

    would likely have the higher melting point?

    CIS or TRA

    Explain your answer

    What is a lipid? a fat? an oil?

    What are the types of fat rancidity? For each: what are the

    factors promoting this type of rancidity and the products resulting?

    What are some of the special treatments given to rendered

    animal fats or crude vegetable oils to make them more desirable

    products for certain purposes?

    What is an emulsion? Discuss factors giving stability.

    With popular emphasis on the use of salad oils, what

    modifications of conventional recipes are necessary to

    substitute these for plastic fats?

    DEFINE THE FOLLOWING

    winterization or rearrangement

    degumming or bleaching

    hydrogenation

    emulsions

    What is the difference between a fat, a oil, a lipid?

    What contributions do fats make in foods? Where do we use fat in

    foods?

    With popular emphasis on the use of salad oils, what modifications of

    conventional recipes are necessary to substitute these for plastic

    fats?

    Complete the diagram below to show the synthesis and hydrolysis of a

    triglyceride.

    H O H O

    | |

    H-C-OH OH-C-(CH2)7CH=CH(CH2)7CH3 H-C- -C-

    (CH2)7CH=CH(CH2)7CH3

    | |

    | O | O

    | |

    H-C-OH OH-C-(CH2)16CH3 ------->H-C- -C-(CH2)16CH3

    | <------- |

    | O | O

    | |

    H-C-OH OH-C-(CH2)7CH=CH(CH2)7CH3 H-C- -C-

    (CH2)7CH=CH(CH2)7CH3

    | |

    H H

    Mastery of the above reaction is not in itself of critical importance;

    however, an understanding of it does serve to explain certain

    phenomena which affect food quality.

    Discuss in what way the previous diagram on the synthesis and

    hydrolysis of a triglyceride relates to hydrolytic rancidity.

    What is oxidative rancidity? What portion of the previous diagram

    relates to oxidative rancidity?

    Coconut oil is inexpensive and often used in commercial food products.

    Coconut oil is a saturated fat. How can this be an oil and yet be

    saturated?

    What would be the most desirable characteristic to consider if you

    were choosing a fat to make French salad dressing?

    What is the major reason a salad dressing is called low calorie?

    In mayonnaise, where would the following be found in the emulsion?

    vinegar PHASE

    oil a. dispersed phase

    paprika b. continuous phase

    emulsifying agent c. interface

    mustard

    Diagrams of chemical formulas of four selected triglycerides.

    H O H O

    | |

    H-C-0-C-(CH2)16-CH3 H-C-0-C-(CH2)7CH=CH(CH2)7CH3

    | O | O

    H-C-O-C-(CH2)14CH3 H-C-O-C-(CH2)7CH=CH-CH2CH=CH(CH2)4CH3

    | O | O

    H-C-O-C-(CH2)7CH=CH(CH2)7CH3 H-C-O-C-(CH2)7CH=CHCH2CH=CH(CH2)4CH3

    | |

    H H

    TRIGLYCERIDE A TRIGLYCERIDE B

    H O H O

    | |

    H-C-O-C-(CH2)14CH3 H-C-O-C-(CH2)14CH3

    | O | O

    H-C-O-C-(CH2)10CH3 H-C-O-C-(CH2)14CH3

    | O | O

    H-C-O-C-(CH2)7CH=CHCH2CH=CH H-C-O-C-(CH2)7CH=CH(CH2)7CH3

    |

    (CH2)4CH3

    TRIGLYCERIDE C TRIGLYCERIDE D

    Using the "Diagrams of Chemical Formulas of Selected

    Triglycerides" answer the following questions. AFter you select

    your answer, write a very brief justification of your choice.

    Which triglyceride likely has the lowest melting point?

    Which triglyceride likely has the widest plastic range?

    Which triglyceride likely has the narrowest plastic range?

    Which fat is likely the most susceptible to changes brought

    about by hydrogenation?

    Is one of the triglycerides more susceptible to hydrolytic

    rancidity than the others? Which, or why?

    Is one of the triglycerides more susceptible to oxidative

    rancidity than the others? Which or why?

    Which triglyceride likely has the highest smoke point?

    Which triglyceride most likely needs to be kept

    refrigerated?

    Which triglyceride is best to use in salad

    dressing/mayonnaise preparation?

    Which is best to use in deepfat frying?

    Which is best to use to make a meally pastry?

    Which triglyceride has the most pronounced odor?

    Which triglycerides is most likely an oil?

    Which triglyceride is the most effective emulsifying agent?

    Which triglyceride most easy to maintain a foam dispersion?

    Which triglyceride most flavor to a product?

    If one wished to prepare a fat spread (spread for bread) to

    be used in a desert survival program in California, which

    one of the triglycerides would predominant?

    What would be the influence of adding a monoglyceride to fat

    D on smoke point?

    Which triglyceride would likely be incorporated in shortening to

    be used as an emulsifier for a shortened cake?

    Which of the following triglycerides (fats) would be most firm at room

    temperature 27C, 70F)?

    a. tristearin (contains 18 carbon saturated fatty acids)

    b. triolein (contains 16 carbon saturated fatty acids)

    c. triliolein (contains 18 carbons and 2 double bonds in fatty

    acids)

    d. tributyrin (contains 4 carbon saturated fatty acids)

    One day some butter melted and Hillary decided to cool it slowly.

    Which of the following best describes this product? (Note: think of

    the results in comparison of contrast of the melted butter rapidly

    cooled).

    a. This butter would likely have better plascitiy.

    b. Cooling rate does not influence crystallinity in fats.

    c. The dispersion would likely look more solid as opposed to

    showing the crystals in oily oil dispersion.

    d. The cooled butter likely would have large crystals dispersed

    in an "oily" appearing medium.

    a type of lipid consisting chemically of one molecule of glycerol

    combined with three fatty acids

    a. fatty acid

    b. monoglyceride

    c. phospholipid

    d. sterol

    e. triglyceride

    deterioration of fats, usually by an oxidation process, resulting in

    objectionable flavors and odors.

    a. frying

    b. hydrogenation

    c. isomerization

    d. rancidity

    e. winterization

    term used to describe a broad group of substances with similar

    properties or characteristics of insolubility in water and a greasy

    feel.

    a. carbohydrate

    b. cellulose

    c. lipid

    d. protein

    a substance that stops unwanted oxidations

    a. antioxidant

    b. emulsifying agent

    c. oxidant

    d. rancidity

    e.

    Term to describe the ability of a fat to be molded or shaped.

    a. emulsification

    b. hydrogenation

    c. plasticity

    d. rancidity

    e. winterization

    Term for removal of triglycerides with high melting points from oil to

    be used as salad oil

    a. emulsification

    b. hydrogenation

    c. plasticity

    d. rancidity

    e. winterization

    Term for process to change liquid oils to solid or pliable

    shortenings.

    a. emulsification

    b. hydrogenation

    c. plasticity

    d. rancidity

    e. winterization

    Term for deterioration of fats resulting in objectionable odor or

    flavor.

    a. emulsification

    b. hydrogenation

    c. plasticity

    d. rancidity

    e. winterization

    A fatty acid with no double bonds between carbon atoms; it holds all

    of the hydrogen that can be attached to the carbon atoms

    a. linolenic acid

    b. linoleic acid

    c. saturated fatty acid

    d. oleic acid

    e. unsaturated fatty acid

    A type of lipid consisting chemically of one molecule of glycerol

    combined with three fatty acids

    a. fatty acid

    b. monoglyceride

    c. phospholipid

    d. sterol

    e. triglyceride

    Which of the following triglycerides (fats) would be most firm at room

    temperature 27C, 70F)?

    a. tristearin (contains 18 carbon saturated fatty acids)

    b. triolein (contains 16 carbon saturated fatty acids)

    c. triliolein (contains 18 carbons and 2 double bonds in fatty

    acids)

    d. tributyrin (contains 4 carbon saturated fatty acids)

    The characteristics of the fatty acid is very important as generally a

    triglyceride containing fatty acids of equal length but more of the

    fatty acids are saturated than unsaturated would be (as opposed to the

    reverse situation)

    a. more likely to be a liquid at room temperature and be more

    soluble and more polar in liquid (water) dispersions.

    b. more likely to be a solid at room temperature and be less

    polar and less soluble in liquid (water) dispersions.

    c. more likely to be a liquid at room temperature and be less

    soluble and less polar in liquid (water ) dispersions.

    d. more likely to be a solid at room temperature and be more

    polar and more soluble in liquid (water) dispersions.

    One day some butter melted and Hillary decided to cool it slowly.

    Which of the following best describes this product? (Note: think of

    the results in comparison of contrast of the melted butter rapidly

    cooled).

    a. This butter would likely have better plasticitiy.

    b. Cooling rate does not influence crystallinity in fats.

    c. The dispersion would likely look more solid as opposed to

    showing the crystals in oily oil dispersion.

    d. The cooled butter likely would have large crystals dispersed

    in an "oily" appearing medium.

    From the listing on the right hand column, indicate how these

    ingredients and procedures affect mayonnaise formation.

    EMULSION FORMATION

    Refrigerator temperature salad oil. a. Promote emulsion formation

    Egg yolk. b. Inhibit emulsion formation

    Wide, flat bottom bowl. c. No appreciable influence

    Stirring with a spoon rather than on emulsion formation

    beating with a beater.

    Lemon juice used rather than vinegar.

    Previously made mayonnaise is added

    to the egg yolk/vinegar mixture.

    In mayonnaise, where would the following be found in the

    emulsion?

    vinegar a. dispersed phase

    oil b. continuous phase

    paprika c. interface

    emulsifying agent

    Which is a fatty acid with no double bonds between carbon atoms;

    it holds all of the hydrogen that can be attached to the carbon

    atoms

    a. butyric acid

    b. caproic acid

    c. saturated fatty acid

    d. stearic acid

    e. unsaturated fatty acid

    Check each substance which may be used in food products to act as

    an emulsifier.

    a. dry mustard d. oil

    b. water e. paprika

    c. egg yolk f. lemon juice

    The process of adding hydrogen at the double bond of selected

    unsaturated fatty acids to make a more plastic fat is:

    a. rearrangement

    b. winterizing

    c. emulsification

    d. hydrogenation

    What are the differences in stability between saturated and

    unsaturated fats?

    A plastic fat with emulsifiers added is better than one without

    for use in which of the following products?

    What is the definition of hydrogenated fat?

    Differences in stability between saturated and unsaturated fats

    include what characteristics?

    Which of the following triglycerides (fats) would be most firm at

    room temperature 27À$ÀC, 70À$ÀF)?

    a. Tristearin (contains 18 carbon saturated fatty acids)

    b. Triolein (contains 16 carbon saturated fatty acids)

    c. Trilinolein (contains 18 carbons and 2 double bonds in fatty

    acids)

    d. Tributyrin (contains 4 carbon saturated fatty acids)

    Which of the following most accurately reflects triglycerides

    role in fats?

    a. Triglycerides make up fats and permits the accurate

    prediction of the characteristics of the fats.

    b. Triglycerides are organic compounds which are

    occasionally found in fats; but, fats are really only

    made up of lipids.

    c. Fats are complex ingredients made up of many component

    parts so there is just no way to find out the

    characteristics of the fats.

    What is a common fat, which in composition is only 80% fat?

    Processing the two terms at the left, indicate the correct type

    of rancidity that would occur for each situation.

    A. oxidative rancidity triglyceride is split to

    glycerol and

    B. hydrolytic rancidity free fatty acid

    presence of lipase

    an oxygen interceptor

    (antioxidant

    helps prevent this

    saturated fatty acids

    involved

    Define and indicate the three major catagories of lipids.

    Why are simple and mixed glycerides important?

    Which of the following most accurately reflects triglycerides

    role in fats?

    a. triglycerides make up fats and permits the accurate

    prediction of the characteristics of the fats.

    b. triglycerides are organic compounds which are

    occasionally found in fats; but, fats are really only made

    up of lipids.

    c. fats are complex ingredients made up of many component

    parts so there is just no way to find out the

    characteristics of the fats.

    Define the following:

    refined fats and oils used in food preparation, including

    edible oils, margarine, butter, lard, and shortenings

    a chemical molecule consisting of carbon and hydrogen atoms

    bonded in a chainlike structure; combined through its acid

    group (-COOH) with the alcohol glycerol to form

    triglycerides.

    temperature at which a solid fat becomes a liquid oil

    ability to be molded or shaped; in plastic fats, both solid

    crystals and liquid oil are present

    describing substances that cannot be mixed or blended

    an enzyme that activates hydrolytic rancidity in a

    triglyceride

    amount of oil required by USDA to label a permanent emulsion

    mayonnaise

    deterioration of fats, usually by an oxidation process,

    resulting in objectionable flavors and odors.

    The process of adding hydrogen at the double bond of

    selected unsaturated fatty acids to make a more plastic fat

    Indicate whether the following statements are true or false.

    saturated fats are not susceptible to any rancidity

    unsaturated fats are a liquid so rancidity is not a problem

    antioxidants must be added to any saturated fat to prevent

    rancidity

    unsaturated fats are more readily susceptible to a common

    type of oxidative rancidity

    Fats should be stored best stored in which of the following

    a. in a warm place

    b. no longer than one week

    c. in a dark air-tight container

    d. in the pan used for deep fat frying

    Check each substance which may be used in food products to act as

    an emulsifier.

    dry mustard oil

    water paprika

    egg yolk lemon juice

    What is the rationale for choosing the right olive oil? ?
    What are characteristics of selected fatty acids?



    to Top


    E-mail Food Resource. Click Either Envelope To Send Questions & Comments to: Food Resource

    URL Home: <http://food.oregonstate.edu/>

    Email maybe sent to food at oregonstate.edu

    Updated: Wednesday, April 21, 2010.
    Oregon State University.

    OSU Disclaimer.